Index of /uploads/clients
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 1-oak-construction/ | 2025-03-03 12:08 | - | |
| 1 Oak Construction/ | 2023-02-15 10:45 | - | |
| 4Sight Environmental..> | 2021-10-20 18:56 | - | |
| 12-rivers-masonry-inc/ | 2024-09-09 21:34 | - | |
| 12 Rivers Masonry Inc./ | 2024-04-19 17:21 | - | |
| A & A Fence Company/ | 2020-09-04 18:20 | - | |
| A & M Biomedical, Inc./ | 2024-04-26 12:30 | - | |
| A-ONE Roof Managemen..> | 2024-04-26 12:27 | - | |
| A.C. Enterprises/ | 2024-04-19 17:23 | - | |
| A. Flores Excavating..> | 2024-06-04 13:19 | - | |
| AAA Paving Company/ | 2024-06-04 13:47 | - | |
| AA Masonry/ | 2024-06-04 13:45 | - | |
| ABS Auto Auction/ | 2019-11-12 11:42 | - | |
| ACSS, Inc/ | 2019-02-22 14:24 | - | |
| A Cone Zone, Inc./ | 2019-11-20 17:30 | - | |
| ADCO Roofing North H..> | 2024-11-04 17:36 | - | |
| ADCO South Roofing &..> | 2024-04-26 13:38 | - | |
| ADL Painting and Wal..> | 2022-06-24 13:43 | - | |
| AJD Construction/ | 2021-12-10 18:13 | - | |
| AJ Project Managemen..> | 2024-04-26 13:54 | - | |
| AMCAL/ | 2018-10-26 19:53 | - | |
| AMX Mechanical/ | 2022-04-01 12:38 | - | |
| A Plus Demo, Inc./ | 2024-04-26 12:47 | - | |
| Abarca Construction,..> | 2024-06-04 13:49 | - | |
| Accel Framing/ | 2022-11-23 14:41 | - | |
| Ace Crane Service, I..> | 2024-04-26 12:53 | - | |
| Ace Electric Fresno/ | 2021-01-05 17:14 | - | |
| Acme Drywall Services/ | 2024-04-26 13:12 | - | |
| Action Energy/ | 2022-06-16 19:32 | - | |
| Action Roofing/ | 2021-08-27 12:10 | - | |
| Adco Roofing/ | 2021-04-19 12:37 | - | |
| Advanced Automated S..> | 2019-06-20 11:09 | - | |
| Advanced Concepts/ | 2024-06-04 13:50 | - | |
| Advanced Flow Engine..> | 2024-06-04 13:50 | - | |
| Aftershock Electric ..> | 2024-06-04 13:51 | - | |
| Air Cleaning Technol..> | 2024-04-26 13:51 | - | |
| Air Conditioning Sol..> | 2020-09-24 19:20 | - | |
| Airport Specialists/ | 2020-05-08 15:00 | - | |
| Al Miller & Sons Roo..> | 2024-06-04 13:53 | - | |
| Albino Construction,..> | 2024-04-26 13:56 | - | |
| All Seasons North Ro..> | 2020-09-25 11:34 | - | |
| Allied Steel Co., Inc./ | 2024-06-04 13:54 | - | |
| Alloy Machining Serv..> | 2024-04-26 14:06 | - | |
| Almendariz Consulting/ | 2022-04-28 15:58 | - | |
| Alta Roofing & Water..> | 2024-04-26 14:13 | - | |
| Alvichard Testing/ | 2020-12-01 18:41 | - | |
| American Contractors..> | 2019-04-30 16:38 | - | |
| American Precision H..> | 2024-04-26 14:21 | - | |
| American Restore, Inc./ | 2024-04-26 14:32 | - | |
| American Roof Tops, ..> | 2024-06-04 13:56 | - | |
| Ameripec Incorporated/ | 2024-04-26 14:34 | - | |
| Amigos Professional ..> | 2019-03-19 14:39 | - | |
| Apex Fire Systems, I..> | 2019-05-02 18:47 | - | |
| Applied Building Svc..> | 2024-04-26 14:50 | - | |
| Arantine Hills Holdi..> | 2024-05-01 18:32 | - | |
| Archuleta Concrete C..> | 2024-06-04 14:02 | - | |
| Ardent General/ | 2019-12-23 11:47 | - | |
| Ardent General inc/ | 2025-02-11 13:46 | - | |
| Arrow Cranehoist Cor..> | 2024-04-26 14:51 | - | |
| Artesian Products, I..> | 2024-06-04 14:12 | - | |
| Ashwood Construction..> | 2024-04-19 17:25 | - | |
| Askew Industrial Cor..> | 2024-04-26 14:53 | - | |
| Atlas Roofing & Waer..> | 2024-04-26 12:10 | - | |
| Ausley Construction/ | 2023-02-21 17:55 | - | |
| AvalonBay Communitie..> | 2024-04-26 15:41 | - | |
| AvalonBay Communitie..> | 2024-04-26 15:38 | - | |
| Avanti Windows and D..> | 2020-12-21 12:30 | - | |
| B & B Construction S..> | 2024-04-19 17:27 | - | |
| B. A. M. Landscapes ..> | 2024-06-04 14:13 | - | |
| B.D. White Top Soil ..> | 2024-04-26 15:43 | - | |
| BA2 LLC/ | 2025-01-17 11:50 | - | |
| BCI General Contract..> | 2019-10-30 16:52 | - | |
| BCS Enterprises, Inc./ | 2024-04-19 17:30 | - | |
| BJ Perch Construction/ | 2019-06-25 11:51 | - | |
| BMY Construction/ | 2019-08-06 11:40 | - | |
| Back Nine Greens/ | 2024-06-04 14:18 | - | |
| Baghouse & Industria..> | 2019-06-14 15:39 | - | |
| Baker Electric/ | 2019-12-23 11:52 | - | |
| Bakman Water/ | 2023-08-01 16:36 | - | |
| Balboa Boat Yard/ | 2024-04-26 16:28 | - | |
| Baldwin Construction/ | 2024-05-13 11:03 | - | |
| Barkley Sheet Metal/ | 2024-04-26 16:29 | - | |
| Barnett Refrigeration/ | 2022-05-13 17:36 | - | |
| Barnhart-Benson Buil..> | 2024-04-19 17:28 | - | |
| Basin Safety Consult..> | 2020-07-14 17:57 | - | |
| Bay City Boiler/ | 2023-12-13 10:42 | - | |
| Baymar Constructors,..> | 2024-04-19 17:29 | - | |
| Baymarr/ | 2021-01-27 14:18 | - | |
| Beachside Construction/ | 2024-04-26 16:30 | - | |
| Beaumont - Cherry Va..> | 2024-06-04 14:23 | - | |
| Beaumont-Cherry Vall..> | 2024-06-04 14:22 | - | |
| Bedrosian/ | 2024-07-16 16:37 | - | |
| Bell Roof ASI/ | 2020-01-22 16:42 | - | |
| Bell Roof Company/ | 2024-06-04 14:27 | - | |
| Bella Vista Landscap..> | 2023-04-06 09:31 | - | |
| Best Framing/ | 2024-04-19 17:30 | - | |
| Best Western Plus Gl..> | 2024-04-26 16:31 | - | |
| Beyond Heating and Air/ | 2022-06-16 19:31 | - | |
| Bill Cleavelin Mason..> | 2019-06-03 17:13 | - | |
| Blaine Steele/ | 2021-09-02 17:11 | - | |
| Blair Church and Fly..> | 2020-12-17 12:11 | - | |
| Blair Church and Fly..> | 2021-04-02 14:40 | - | |
| Blair Church and Fly..> | 2021-04-02 14:42 | - | |
| Blake Roofing, Inc./ | 2024-04-26 16:32 | - | |
| Bob Marshall Constru..> | 2024-04-19 17:31 | - | |
| Bogh Engineering, Inc./ | 2024-06-04 14:28 | - | |
| Bonadelle Homes, Inc/ | 2019-02-11 11:05 | - | |
| Boozak, Incorporated/ | 2024-04-26 16:35 | - | |
| Bradshaw Constructio..> | 2024-06-04 14:35 | - | |
| Brady West, Inc./ | 2024-04-26 16:40 | - | |
| Brawley Investment V..> | 2022-08-31 16:23 | - | |
| Brayden Construction/ | 2022-05-19 17:20 | - | |
| Bright Homes/ | 2024-01-02 11:54 | - | |
| Brookbank Core Drill..> | 2023-02-22 22:28 | - | |
| Browning Contractors..> | 2020-06-03 13:15 | - | |
| Build Group Inc./ | 2024-04-26 16:41 | - | |
| Bush Construction/ | 2020-11-30 11:21 | - | |
| C&M Dredging/ | 2022-12-22 15:30 | - | |
| C. A. Hofmann Constr..> | 2024-04-26 16:42 | - | |
| C.M. Machine Inc./ | 2024-06-04 14:55 | - | |
| C.W. Dillon/ | 2024-08-14 17:05 | - | |
| CJW General Contract..> | 2024-06-04 16:11 | - | |
| CLK Development, Inc./ | 2023-03-22 17:11 | - | |
| CLK Development/ | 2023-05-18 18:08 | - | |
| CNS Mechanical/ | 2020-09-24 14:13 | - | |
| CP Construction Comp..> | 2024-06-04 16:13 | - | |
| Cabinet Connection/ | 2023-08-23 15:27 | - | |
| Cal-Mesa Steel Suppl..> | 2024-06-04 14:57 | - | |
| Cal Coast Telecom/ | 2022-09-21 18:32 | - | |
| Cal Custom Tile/ | 2024-04-19 17:32 | - | |
| CalPac Sheet Metal/ | 2024-08-13 16:28 | - | |
| CalPrem/ | 2019-01-03 12:32 | - | |
| Cal Pro Management I..> | 2024-04-26 16:44 | - | |
| Calcom Roofing, Inc./ | 2024-06-04 15:00 | - | |
| Cali-Built Construct..> | 2024-06-04 15:07 | - | |
| Calidad, Inc./ | 2024-06-04 15:41 | - | |
| California Commercia..> | 2024-06-04 15:43 | - | |
| California Environme..> | 2021-05-19 16:21 | - | |
| California Tile Inst..> | 2022-05-02 14:20 | - | |
| Callaghan Concrete C..> | 2024-06-04 15:45 | - | |
| Calmoseptine, Inc./ | 2024-04-26 16:46 | - | |
| Cambelt/ | 2021-03-30 13:04 | - | |
| Can Lines Engineerin..> | 2024-04-26 16:47 | - | |
| Canyon Lake P.O.A. C..> | 2024-06-04 15:47 | - | |
| CapRock Partners/ | 2024-04-26 16:53 | - | |
| Capsule/ | 2024-04-26 16:56 | - | |
| Cargomatic Incorpora..> | 2024-04-26 16:57 | - | |
| Cascade Build/ | 2019-06-20 15:44 | - | |
| Caster Properties/ | 2021-04-07 16:23 | - | |
| Catalina Material Ha..> | 2024-04-26 17:00 | - | |
| Caufield Equipment L..> | 2024-04-26 17:01 | - | |
| Cedar Roofing Company/ | 2023-05-22 18:55 | - | |
| Cencal Builders/ | 2021-07-09 14:31 | - | |
| Cencal Services/ | 2023-08-30 18:48 | - | |
| Central Roofing/ | 2020-10-21 18:49 | - | |
| Century Communities-..> | 2019-01-24 15:20 | - | |
| Century Communities-..> | 2019-01-24 15:08 | - | |
| Century Communities ..> | 2019-01-24 12:57 | - | |
| Century Communities-..> | 2019-01-24 14:01 | - | |
| Century Communities-..> | 2019-01-24 14:59 | - | |
| Century Communities-..> | 2019-01-24 15:04 | - | |
| Century Communities-..> | 2019-01-24 15:15 | - | |
| Century Communities-..> | 2019-01-24 14:16 | - | |
| Century Communities-..> | 2019-01-24 15:12 | - | |
| Century Communities-..> | 2019-01-24 14:54 | - | |
| Century Communities-..> | 2019-01-24 14:25 | - | |
| Century Communities-..> | 2019-01-24 15:37 | - | |
| Century Communities-..> | 2019-01-24 13:46 | - | |
| Century Communities/ | 2018-08-17 09:29 | - | |
| Cerno LLC/ | 2024-04-26 17:04 | - | |
| CertaPro Painters of..> | 2023-03-15 13:51 | - | |
| Champion Lumber Comp..> | 2019-12-11 11:37 | - | |
| Chatfield Clarke Com..> | 2024-06-04 15:48 | - | |
| Chelsea Investment Co./ | 2021-03-25 15:33 | - | |
| Chesmar Homes/ | 2023-07-05 12:50 | - | |
| Chesmar Homes: Austin/ | 2023-11-21 10:00 | - | |
| Chesmar Homes: Centr..> | 2023-11-20 10:33 | - | |
| Chesmar Homes: Dallas/ | 2023-12-06 10:47 | - | |
| Chesmar Homes: Dalla..> | 2024-09-12 19:41 | - | |
| Chesmar Homes: Dalla..> | 2024-02-16 21:13 | - | |
| Chesmar Homes: Houst..> | 2023-11-13 16:50 | - | |
| Chesmar Homes: Houst..> | 2023-11-10 11:58 | - | |
| Chesmar Homes: Houst..> | 2023-12-30 16:01 | - | |
| Chesmar Homes: San A..> | 2023-11-20 15:19 | - | |
| Chris Meekins Backho..> | 2024-06-04 15:49 | - | |
| Chris Riggins Constr..> | 2024-06-10 16:36 | - | |
| Christensen Construc..> | 2024-04-19 17:07 | - | |
| Circle City Roofing/ | 2024-09-26 18:13 | - | |
| CityMark Development/ | 2024-04-26 17:24 | - | |
| City Of Carson / | 2025-01-17 11:38 | - | |
| City of Banning Water / | 2024-06-04 15:50 | - | |
| City of Beaumont/ | 2024-06-04 15:52 | - | |
| City of Menifee/ | 2024-06-04 15:53 | - | |
| City of Rancho Mirage/ | 2024-06-04 16:10 | - | |
| Civil West Engineering/ | 2024-01-20 09:55 | - | |
| Clovis Recycling Cen..> | 2025-01-14 16:51 | - | |
| Coast Concrete Inc./ | 2022-12-08 11:38 | - | |
| Coastal Construction/ | 2024-04-26 17:30 | - | |
| Coastal Construction..> | 2023-05-05 16:33 | - | |
| Colombo Construction..> | 2024-05-06 19:34 | - | |
| Columbia Steel Inc./ | 2019-11-20 21:08 | - | |
| Commerce Constructio..> | 2024-06-03 14:26 | - | |
| Commercial Roofing S..> | 2024-04-26 17:35 | - | |
| Concrete North, Inc./ | 2019-01-29 12:53 | - | |
| Confab Construction ..> | 2024-11-21 17:01 | - | |
| Construction Group S..> | 2019-10-10 17:47 | - | |
| Contract Label/ | 2019-12-05 12:20 | - | |
| Core Contracting, Inc./ | 2024-04-26 18:20 | - | |
| Corridor Recycling / | 2025-01-17 11:54 | - | |
| Costa Roof/ | 2021-02-19 17:54 | - | |
| Crawford Custom Homes/ | 2023-04-26 12:38 | - | |
| Critical Electric Sy..> | 2024-06-04 16:15 | - | |
| Crossterra Line Loca..> | 2023-03-02 15:11 | - | |
| Crosstown: Traffic S..> | 2024-08-12 14:13 | - | |
| Crosstown Electrical..> | 2021-10-05 15:42 | - | |
| Crosstown Electrical..> | 2021-11-23 12:45 | - | |
| Crosstown Electrical..> | 2022-01-04 10:01 | - | |
| Crosstown Electrical..> | 2021-11-30 04:15 | - | |
| Crosstown Electrical..> | 2024-09-30 14:38 | - | |
| Crosstown Electrical..> | 2021-10-21 14:17 | - | |
| Current Electrical C..> | 2019-05-02 14:36 | - | |
| Current Solutions/ | 2023-09-12 17:32 | - | |
| Custom Quality Const..> | 2024-04-29 16:40 | - | |
| D&D Construction Spe..> | 2021-08-27 12:50 | - | |
| D&D Plastering Enter..> | 2024-06-04 16:16 | - | |
| D.R. Horton - Centra..> | 2019-05-24 15:40 | - | |
| D.R. Horton/ | 2025-02-13 12:31 | - | |
| D.R. Horton: Corona/ | 2024-08-27 14:08 | - | |
| D.R. Horton Americas..> | 2025-02-18 10:54 | - | |
| D.R. Horton Los Ange..> | 2024-06-03 14:35 | - | |
| D.R. Horton Sacramento/ | 2019-04-24 13:28 | - | |
| D.R. Horton Utah/ | 2020-06-17 11:35 | - | |
| D.W. Johnston Constr..> | 2024-06-04 16:17 | - | |
| DAI General Contract..> | 2019-09-17 16:17 | - | |
| DBKO/ | 2023-02-09 16:51 | - | |
| DBaC, Inc./ | 2024-04-29 16:47 | - | |
| DDCM Inc. / | 2025-01-10 10:47 | - | |
| DES Electrical, Inc./ | 2020-02-17 12:46 | - | |
| DN Harvesting/ | 2024-08-27 15:20 | - | |
| DR Horton/ | 2022-01-28 11:34 | - | |
| DSCM, Inc./ | 2024-06-04 16:34 | - | |
| Da/ | 2018-08-28 14:49 | - | |
| Dak-Cal Glass, Inc. ..> | 2024-06-04 16:17 | - | |
| Dalke & Sons Constru..> | 2024-06-04 16:18 | - | |
| Data Impressions, DI..> | 2024-09-23 16:41 | - | |
| Dave Williams Plumbi..> | 2024-06-04 16:20 | - | |
| David Knight Farming/ | 2024-06-04 16:21 | - | |
| Davis Moreno Constru..> | 2024-04-19 17:06 | - | |
| Dayan Industries/ | 2025-01-17 11:58 | - | |
| DeAnza Termite Pest ..> | 2024-06-04 16:23 | - | |
| De Young Properties/ | 2025-02-18 11:37 | - | |
| Deadwood Construction/ | 2023-02-07 19:03 | - | |
| Decor-Ware Inc./ | 2024-06-04 16:23 | - | |
| Dehart Construction ..> | 2024-06-04 16:29 | - | |
| Delta Mechanical Ser..> | 2025-03-03 14:00 | - | |
| Dennis Cook Roofing/ | 2024-03-13 17:22 | - | |
| Desert Champions, LLC/ | 2024-06-04 16:31 | - | |
| Devco Sandblasting &..> | 2024-06-04 16:33 | - | |
| Deyoung Power/ | 2022-04-13 15:22 | - | |
| Documotion Research,..> | 2024-04-30 12:29 | - | |
| Domingos 54 Construc..> | 2020-08-27 15:13 | - | |
| Donlon Builders Inc./ | 2024-04-30 12:30 | - | |
| Ducros Electrical Co..> | 2019-04-09 12:52 | - | |
| Dupree, Inc./ | 2024-06-04 16:36 | - | |
| Dura Plastic Product..> | 2024-06-04 16:47 | - | |
| Durham Construction ..> | 2024-04-19 17:33 | - | |
| E.J. Masonry/ | 2022-08-11 00:01 | - | |
| E.J. Meyer Company/ | 2024-06-06 12:42 | - | |
| EBlock Corp./ | 2024-06-04 17:31 | - | |
| EER, Inc./ | 2022-11-30 13:04 | - | |
| EKC/ | 2023-11-02 14:58 | - | |
| Eagle Development & ..> | 2024-04-29 17:00 | - | |
| East Valley Water Di..> | 2024-06-04 17:21 | - | |
| Easy Rooter Plumbing..> | 2024-06-04 17:23 | - | |
| Ecklund Roofing, Inc..> | 2024-06-04 17:39 | - | |
| Ed Grush General Con..> | 2024-05-14 15:57 | - | |
| Edge Homes/ | 2019-02-14 08:26 | - | |
| Edge Plastics, Inc./ | 2024-06-04 17:42 | - | |
| Ekedal Concrete, Inc/ | 2024-07-25 11:28 | - | |
| Electric Art, Inc./ | 2024-04-29 17:13 | - | |
| Electrical Power Sou..> | 2022-07-14 16:10 | - | |
| Elite Construction &..> | 2023-03-16 16:36 | - | |
| Emmerson Construction/ | 2021-03-02 14:29 | - | |
| Emmett Excavation/ | 2020-02-13 19:30 | - | |
| Empire Pipe Cleaning/ | 2020-05-27 14:37 | - | |
| Empyrean Plumbing/ | 2025-01-13 09:17 | - | |
| Erbe Engineering, Inc./ | 2024-06-04 17:42 | - | |
| Essential Roofing/ | 2021-03-22 14:32 | - | |
| Evergreen Environmen..> | 2019-05-10 16:58 | - | |
| Exscape Designs/ | 2023-05-30 12:58 | - | |
| F.E.C. Electric, Inc./ | 2024-06-04 17:43 | - | |
| FCB Homes/ | 2024-04-19 17:08 | - | |
| FMB Development/ | 2020-12-02 15:59 | - | |
| FOS of CannonDesign/ | 2021-10-15 15:21 | - | |
| FTDI West Inc./ | 2024-06-04 18:31 | - | |
| Fairchild Plumbing &..> | 2024-06-04 17:44 | - | |
| Fairfield/ | 2025-01-17 12:10 | - | |
| Family 1 Auto Body, ..> | 2024-06-04 17:54 | - | |
| Far West Industries/ | 2024-06-04 18:21 | - | |
| Fidelis Green/ | 2023-04-19 14:29 | - | |
| Field Talent / | 2019-08-05 19:30 | - | |
| Fieldstone Homes/ | 2020-04-28 12:15 | - | |
| Final Touch Construc..> | 2024-06-04 18:29 | - | |
| Finn Construction an..> | 2024-04-29 17:23 | - | |
| Fire System Solution..> | 2020-06-10 09:46 | - | |
| Fix Auto Puget Colli..> | 2025-01-17 12:17 | - | |
| Flamingo Construction/ | 2019-02-19 17:25 | - | |
| Fontaine Weatherproo..> | 2023-10-24 12:56 | - | |
| FoundationForForm Ar..> | 2021-09-29 16:43 | - | |
| Four Star Rebar/ | 2022-11-15 13:44 | - | |
| Freeman Restoration/ | 2024-06-04 18:29 | - | |
| Fresno Concrete Cons..> | 2024-04-19 17:34 | - | |
| Fresno Plastering/ | 2024-06-27 16:09 | - | |
| Fresno Valve & Casting/ | 2019-07-18 12:10 | - | |
| Fritz Construction/ | 2021-04-19 15:00 | - | |
| G.D. Heil, Inc./ | 2024-04-29 17:25 | - | |
| G.O. Langlois Constr..> | 2024-06-04 18:32 | - | |
| GAMA Construction / | 2022-09-19 17:40 | - | |
| GDM Landscape/ | 2024-04-02 14:58 | - | |
| GJ Gentry General En..> | 2024-04-29 17:31 | - | |
| GL Bruno/ | 2024-09-18 11:37 | - | |
| GRANITE MOUNTAIN STO..> | 2025-01-17 12:31 | - | |
| GTS/ | 2024-06-27 16:25 | - | |
| Galleher Acquistion ..> | 2024-06-04 18:32 | - | |
| Galligan Ryan Associ..> | 2021-05-05 12:20 | - | |
| Gambril/ | 2021-03-30 18:30 | - | |
| Ganahl Construction/ | 2021-08-16 11:16 | - | |
| Gary McDonald Homes,..> | 2024-04-19 17:34 | - | |
| Genova Construction ..> | 2024-04-29 17:30 | - | |
| Glass Factory, Inc./ | 2024-06-04 18:38 | - | |
| Glen Capri Hotel/ | 2024-04-29 17:35 | - | |
| Gonzalez Inc./ | 2024-04-19 17:09 | - | |
| Gordon Painting Co.,..> | 2024-06-04 18:51 | - | |
| Graham Prewett/ | 2023-04-05 21:25 | - | |
| Graham Prewettt/ | 2023-03-23 11:40 | - | |
| Granite Masterz, Inc./ | 2024-04-29 17:37 | - | |
| Grant Construction, ..> | 2019-04-18 19:09 | - | |
| Granville Homes, Inc./ | 2020-10-08 15:02 | - | |
| Greystone Plastering/ | 2021-06-30 12:56 | - | |
| Grounds Electric Co ..> | 2022-08-25 14:18 | - | |
| Grounds Electric Com..> | 2024-06-05 10:58 | - | |
| Guy Yocom Constructi..> | 2018-12-13 19:47 | - | |
| Guy Yocum Construction/ | 2025-01-16 17:18 | - | |
| H&H Construction/ | 2020-03-03 15:10 | - | |
| HBI Construction, Inc./ | 2024-04-29 17:52 | - | |
| HCI Environmental an..> | 2019-11-20 13:12 | - | |
| HMC Construction, Inc./ | 2024-06-05 11:08 | - | |
| HMS Investments Inc./ | 2024-04-29 17:55 | - | |
| HR Freight, Incorpor..> | 2024-04-29 18:16 | - | |
| HYATT REGENCY INDIAN..> | 2024-06-05 11:23 | - | |
| Hallin & Herrera, Inc./ | 2024-06-05 11:01 | - | |
| Hamlet Homes (Utah)/ | 2019-11-20 17:22 | - | |
| Hanover RS Construct..> | 2024-04-29 17:42 | - | |
| Harber Companies, Inc./ | 2024-06-05 11:02 | - | |
| Harris Construction/ | 2020-05-18 18:34 | - | |
| Helio/ | 2021-02-26 16:57 | - | |
| Hetal Patel/ | 2021-10-27 12:12 | - | |
| Hideaway Maintenance/ | 2024-06-05 11:07 | - | |
| High Light Electric ..> | 2023-05-11 17:24 | - | |
| Hiltys Electrical Co..> | 2019-06-07 16:19 | - | |
| Hodgdon Management a..> | 2024-06-05 11:09 | - | |
| Holt Homes/ | 2024-08-12 14:53 | - | |
| Honeys Air and Solar/ | 2023-01-25 18:12 | - | |
| Hope Plastics/ | 2024-04-29 17:59 | - | |
| Hoyt Roofs, Inc./ | 2024-04-29 18:15 | - | |
| Hubbel Homes/ | 2022-08-29 14:22 | - | |
| Hubble Homes/ | 2023-09-12 09:56 | - | |
| Huff Construction Co..> | 2021-03-15 14:11 | - | |
| Humphrey Plumbing/ | 2021-03-24 09:30 | - | |
| Husqvarna-Austell, GA/ | 2024-06-05 11:18 | - | |
| Husqvarna-Branford, CT/ | 2024-06-05 11:18 | - | |
| Husqvarna-Carrolton,..> | 2024-06-05 11:19 | - | |
| Husqvarna-Corona,CA/ | 2024-06-05 11:20 | - | |
| Husqvarna-Elk Grove ..> | 2024-06-05 11:21 | - | |
| Husqvarna-Lenexa, KS/ | 2024-06-05 11:21 | - | |
| Hy - Tech Tile Inc./ | 2024-06-05 11:22 | - | |
| Hydraulic Rod Pumps,..> | 2024-04-29 18:17 | - | |
| Hydroform USA, Inc./ | 2024-04-29 18:19 | - | |
| Impact Construction / | 2022-04-26 18:35 | - | |
| Inca Plastics Moldin..> | 2024-06-05 11:28 | - | |
| Indigoicon New/ | 2018-11-30 11:16 | - | |
| Inland Building Cons..> | 2024-10-17 15:02 | - | |
| Inland Empire Roofin..> | 2024-06-05 11:36 | - | |
| Innovative Metal Ind..> | 2024-08-07 19:00 | - | |
| Integrated Construct..> | 2024-06-05 12:50 | - | |
| Interface Air Repair..> | 2024-04-29 18:40 | - | |
| J & K Drywall & Meta..> | 2024-06-05 12:56 | - | |
| JAL Inc/ | 2020-10-26 21:02 | - | |
| JB3D/ | 2022-12-27 13:11 | - | |
![[ ]](/icons/layout.gif) | JHA CalVet.pdf | 2021-01-21 16:33 | 480K | |
| J Jireh Builders Inc./ | 2024-06-05 13:00 | - | |
| JK Insulation/ | 2022-10-31 16:47 | - | |
| JMAN at the Q, L.P./ | 2024-11-18 10:52 | - | |
| J M Builders, Inc./ | 2024-06-05 13:01 | - | |
| J Matt Construction ..> | 2025-01-17 12:44 | - | |
| JPI Development Grou..> | 2024-04-29 18:46 | - | |
| JSB Builders/ | 2022-03-25 13:02 | - | |
| JS Sullivan Construc..> | 2024-05-28 11:29 | - | |
| JWCIB Inc dba Cavignac/ | 2024-04-29 18:47 | - | |
| Jan Building/ | 2025-01-17 12:47 | - | |
| Janet Anderson/ | 2023-08-22 14:02 | - | |
| Jaz Plastering/ | 2024-04-29 18:41 | - | |
| Jerry Herbert Roofin..> | 2024-06-05 13:04 | - | |
| Jim Crawford Constru..> | 2019-12-17 16:37 | - | |
| John Barajas Masonry/ | 2024-06-05 13:18 | - | |
| Johnson Air/ | 2023-12-13 16:27 | - | |
| Johnstone Moyer Inc...> | 2024-04-29 18:45 | - | |
| Jon Casey Constructi..> | 2024-10-24 14:16 | - | |
| Jon Casey Construction/ | 2020-01-03 13:04 | - | |
| Jonathan Rivas/ | 2020-11-12 15:15 | - | |
| K6 Construction Inc./ | 2019-03-14 11:36 | - | |
| KGG Concrete, Inc./ | 2024-06-05 13:19 | - | |
| KNR Builders/ | 2024-04-29 18:58 | - | |
| KPW/ | 2022-02-25 16:15 | - | |
| Kalban Inc./ | 2024-04-29 18:53 | - | |
| Karsyn Construction/ | 2019-10-09 13:53 | - | |
| Keystone Contracting..> | 2020-01-17 16:52 | - | |
| Kincaid Construction/ | 2024-04-12 09:56 | - | |
| Kincaid Industries/ | 2024-06-05 13:20 | - | |
| Kirkley Corporation/ | 2024-06-05 13:21 | - | |
| Kiwi II Construction..> | 2024-06-05 13:21 | - | |
| Knitter Contracting ..> | 2024-04-29 18:57 | - | |
| Krikorian Constructi..> | 2024-04-30 12:32 | - | |
| Kyocera Medical Tech..> | 2024-06-05 13:22 | - | |
| LA Steel Services, I..> | 2024-06-05 13:23 | - | |
| LV Construction LLC/ | 2022-11-09 10:17 | - | |
| LW Construction Inc/ | 2019-11-05 12:41 | - | |
| La Plant Performance/ | 2024-04-30 12:34 | - | |
| Lake Hemet Municipal..> | 2024-06-05 13:23 | - | |
| Larry Jacinto Constr..> | 2024-06-05 13:26 | - | |
| Larry Jacinto Farmin..> | 2024-06-05 13:30 | - | |
| Larson Rain Gutters/ | 2020-02-18 12:57 | - | |
| Lees Air/ | 2021-03-02 19:41 | - | |
| Legacy CA, Inc./ | 2024-04-19 17:35 | - | |
| Legacy Construction/ | 2019-09-10 11:19 | - | |
| Legacy Specialists: ..> | 2022-09-21 18:29 | - | |
| Lennar Homes of Cali..> | 2024-04-19 17:11 | - | |
| Less Air/ | 2021-02-18 15:00 | - | |
| Lippert Construction..> | 2024-06-05 13:31 | - | |
| Lucas Builders, Inc./ | 2024-04-30 12:35 | - | |
| Lyle Parks Jr., Cons..> | 2024-05-14 15:58 | - | |
| Lynam Industries/ | 2024-06-05 13:36 | - | |
| M & H Electric Fabri..> | 2024-04-30 12:43 | - | |
| M3 Mechanical/ | 2024-04-30 12:53 | - | |
| MASTER SAFETY FILES/ | 2020-05-15 15:40 | - | |
| MCC/ | 2019-10-12 12:43 | - | |
| MCH Electric/ | 2019-02-11 12:11 | - | |
| MCRT California Con..> | 2024-04-26 17:37 | - | |
| MCRT California Cons..> | 2024-04-26 17:40 | - | |
| MDS Construction/ | 2023-08-30 12:33 | - | |
| MJD Concrete Works/ | 2021-01-12 12:31 | - | |
| MJW Framing, Inc./ | 2024-06-05 13:41 | - | |
| M M P Sheet Metals, ..> | 2024-04-30 12:50 | - | |
| Magik Glass and Door/ | 2024-06-05 13:39 | - | |
| Majestic Masonry/ | 2024-08-15 14:10 | - | |
| Marjan Stone/ | 2024-04-26 17:04 | - | |
| Mark Wilson Construc..> | 2020-10-02 14:39 | - | |
| Martin Roofing and S..> | 2023-03-16 16:30 | - | |
| Marvulli INC/ | 2023-09-19 16:16 | - | |
| Matus International,..> | 2024-04-26 17:28 | - | |
| McCaffrey Homes/ | 2023-10-06 11:45 | - | |
| McCain Inc./ | 2021-04-27 14:29 | - | |
| McCurley and Day Mas..> | 2024-04-19 17:36 | - | |
| McDaniel Inc./ | 2024-06-05 13:40 | - | |
| McKellar McGowan LLC/ | 2024-04-26 17:33 | - | |
| Meerkat Salvage Mach..> | 2024-06-05 13:41 | - | |
| Merit Cables Inc./ | 2024-04-26 17:43 | - | |
| Merit Framing Incorp..> | 2024-06-03 14:28 | - | |
| Merrimans, Incorpora..> | 2024-06-11 17:19 | - | |
| Meyers Construction/ | 2020-01-03 18:22 | - | |
| Milestone Constructi..> | 2025-01-06 14:35 | - | |
| Mill Creek Trust/ | 2024-12-05 16:37 | - | |
| Miller Construction/ | 2024-06-11 14:53 | - | |
| Millworks By Design/ | 2024-04-26 17:47 | - | |
| Mission Hills Countr..> | 2024-06-11 14:56 | - | |
| Mitco Industries, Inc./ | 2024-04-26 17:49 | - | |
| Modern Meat, Inc./ | 2024-06-05 13:42 | - | |
| Moldings Plus, Inc./ | 2024-06-05 13:42 | - | |
| Monarch Landscape/ | 2024-07-30 17:45 | - | |
| Moore Quality Galvan..> | 2024-09-06 15:49 | - | |
| Morongo Band of Indi..> | 2024-06-05 13:43 | - | |
| Morongo Band of Miss..> | 2024-06-05 13:44 | - | |
| Morongo Golf Club at..> | 2024-06-05 13:45 | - | |
| Morongo Indian Water..> | 2024-06-05 13:53 | - | |
| Mountain Reload, LLC/ | 2024-06-05 13:54 | - | |
| Murdica Electric Inc./ | 2024-06-05 13:55 | - | |
| NGC Construction, Inc./ | 2020-06-05 18:25 | - | |
| NP Construction Comp..> | 2024-04-29 17:41 | - | |
| NPLC Lost Canyons LLC/ | 2025-01-17 12:49 | - | |
| NVB Equipment/ | 2024-11-07 14:59 | - | |
| Native Sun Construct..> | 2019-04-05 17:42 | - | |
| Near-Cal Corporation/ | 2024-06-03 14:23 | - | |
| Neff Construction/ | 2018-09-24 11:56 | - | |
| Neff Construction Inc./ | 2024-05-01 11:13 | - | |
| New Testing Company ..> | 2021-03-03 11:05 | - | |
| Newton Construction/ | 2023-11-06 16:23 | - | |
| Nexus Construction S..> | 2024-04-29 17:30 | - | |
| Nilson Homes/ | 2021-01-27 12:11 | - | |
| Nina McCorkle/ | 2024-03-12 14:04 | - | |
| Noble Panacea/ | 2021-03-16 16:52 | - | |
| Noble Panacea: Labs ..> | 2021-03-16 16:53 | - | |
| Norman Wright/ | 2020-07-28 13:13 | - | |
| Norman Wright: Outsi..> | 2020-07-28 13:20 | - | |
| Norman Wright: Servi..> | 2020-07-28 13:23 | - | |
| Norman Wright: Wareh..> | 2020-07-28 13:29 | - | |
| Novin Construction/ | 2024-06-05 13:56 | - | |
| Nucor Data Systems M..> | 2025-01-23 19:08 | - | |
| OC Metals/ | 2025-01-17 12:50 | - | |
| Oak Valley Golf - Ma..> | 2024-06-11 15:55 | - | |
| Olea Kiosks Inc./ | 2024-05-15 19:23 | - | |
| Omega Electric/ | 2023-08-15 09:00 | - | |
| Omni Rancho Las Palm..> | 2024-06-05 13:58 | - | |
| Orr Builders/ | 2024-06-05 13:59 | - | |
| Owen James Construct..> | 2024-06-05 13:59 | - | |
| Oxidizers, Inc./ | 2024-06-05 14:00 | - | |
| P.H. Hagopian, Inc./ | 2019-01-22 12:38 | - | |
| PAR Development/ | 2024-06-05 14:12 | - | |
| PCIW Steel Corporation/ | 2024-04-29 18:15 | - | |
| POGO Dog L.L.C. dba ..> | 2024-04-29 18:17 | - | |
| PRW Industries/ | 2024-06-05 14:21 | - | |
| Pabon Construction C..> | 2024-06-03 14:30 | - | |
| Pace Manufacturing LLC/ | 2024-04-29 17:45 | - | |
| Pace Punches, Inc./ | 2024-04-29 17:48 | - | |
| Pacific Apartment Ho..> | 2024-10-01 11:11 | - | |
| Pacific Crest Roofing/ | 2024-05-13 11:02 | - | |
| Pacific Door/ | 2025-01-17 12:52 | - | |
| Pacific Hydrotech/ | 2019-08-21 19:02 | - | |
| Pacific Hydrotech Co..> | 2024-04-30 13:08 | - | |
| Pacific Industrial C..> | 2024-12-19 15:08 | - | |
| Pacific Sheet Metal ..> | 2024-06-05 14:01 | - | |
| Pacific Utility/ | 2020-09-11 15:34 | - | |
| Pacific Waterproofin..> | 2024-04-29 17:51 | - | |
| Pack Plus/ | 2024-08-15 12:59 | - | |
| Paden & Bletscher Co..> | 2025-01-14 14:16 | - | |
| Padgetts Cleaning & ..> | 2024-06-11 17:22 | - | |
| Palisade Builders, I..> | 2024-05-28 11:30 | - | |
| Palm Springs Mirror ..> | 2024-06-05 14:04 | - | |
| Palm Springs Welding..> | 2024-06-05 14:05 | - | |
| Palms To Pines Mirro..> | 2024-06-05 14:07 | - | |
| Paramount Extrusions..> | 2024-04-29 17:53 | - | |
| Parkwest Constructio..> | 2024-06-05 14:14 | - | |
| Pence Construction, ..> | 2024-06-05 14:15 | - | |
| Perry HomesUtah/ | 2025-01-30 10:59 | - | |
| Pevik Construction/ | 2024-02-19 16:45 | - | |
| Pinnick Construction/ | 2019-09-05 20:09 | - | |
| Plumbing Systems Wes..> | 2024-06-05 14:16 | - | |
| Pooles Construction,..> | 2024-04-29 18:20 | - | |
| Porterville Rock/ | 2025-02-25 11:55 | - | |
| Portrait Constructio..> | 2024-06-05 14:17 | - | |
| Positive Electric Co./ | 2023-05-17 07:44 | - | |
| Post Bros Constructi..> | 2025-01-17 12:54 | - | |
| PowerFlex/ | 2024-05-15 19:12 | - | |
| Powers Construction ..> | 2020-08-19 12:03 | - | |
| Precision Stampings ..> | 2024-06-05 14:18 | - | |
| Premier Roofing & Bu..> | 2024-04-29 18:22 | - | |
| Pres-Tek Plastics, I..> | 2024-06-05 14:19 | - | |
| Prestige Mold, Inc./ | 2024-06-05 14:20 | - | |
| Pride Electric Enter..> | 2019-08-05 19:00 | - | |
| Prime Electrical/ | 2021-12-14 10:21 | - | |
| Pro-Craft Constructi..> | 2024-05-17 15:26 | - | |
| Pro Craft/ | 2020-04-06 17:08 | - | |
| Pro West Constructors/ | 2023-08-22 14:03 | - | |
| Proffer Construction/ | 2024-01-29 18:37 | - | |
| Proficient Inc./ | 2024-04-29 18:25 | - | |
| Pulido Cleaning & Re..> | 2024-06-05 14:22 | - | |
| Purus International,..> | 2024-06-05 14:23 | - | |
| Pyro-Comm Systems, I..> | 2024-04-29 18:34 | - | |
| Pyro-Comm Systems, I..> | 2024-04-29 18:36 | - | |
| Pyro-Comm Systems, I..> | 2024-04-29 18:38 | - | |
| Quality Structure/ | 2019-02-22 14:34 | - | |
| R&A Roof/ | 2019-08-20 11:50 | - | |
| R&R Electric/ | 2019-03-04 12:41 | - | |
| R. Deutschman & Asso..> | 2024-04-29 18:45 | - | |
| R.I.S. Electrical Co..> | 2024-06-05 14:25 | - | |
| R C Foster Corporation/ | 2024-04-29 18:41 | - | |
| R D Builders, Inc./ | 2024-06-05 14:24 | - | |
| RIFFE International ..> | 2024-10-24 12:01 | - | |
| RJ Noble/ | 2021-08-04 17:34 | - | |
| RMC Constructors/ | 2018-11-12 16:34 | - | |
| RMS Construction/ | 2024-06-05 14:29 | - | |
| Ranchwood/ | 2023-11-08 18:39 | - | |
| Ranger Enterprises, ..> | 2024-06-05 14:25 | - | |
| Rapid Care, Inc./ | 2024-06-05 14:26 | - | |
| Rawls Construction/ | 2020-03-30 19:46 | - | |
| Raycon / | 2025-01-17 12:59 | - | |
| Red Haul Express, LLC/ | 2024-06-05 14:27 | - | |
| Reep Fire Protection/ | 2024-01-08 16:38 | - | |
| Related California S..> | 2024-04-29 18:48 | - | |
| Reliable Source, Inc./ | 2024-06-05 14:27 | - | |
| Retrofit Services/ | 2019-11-12 11:34 | - | |
| Reyes Masonry & Reyc..> | 2021-08-11 17:23 | - | |
| Richard Herman Const..> | 2023-01-03 10:43 | - | |
| Richmond American/ | 2024-10-08 12:17 | - | |
| RideNow Powersports ..> | 2024-06-05 14:28 | - | |
| Riverside Steel, Inc./ | 2024-04-29 18:50 | - | |
| Rockne Construction ..> | 2024-05-21 14:58 | - | |
| Rohr Steel/ | 2024-06-05 14:30 | - | |
| Roland/ | 2024-07-18 12:08 | - | |
| Rondys Glass Service/ | 2024-06-11 17:28 | - | |
| Roof Asset Managemen..> | 2024-06-05 14:34 | - | |
| Ross Carroll Inc./ | 2024-01-11 13:23 | - | |
| Rubicon Gear, Inc./ | 2024-04-30 12:55 | - | |
| Rubik Construction/ | 2020-09-22 17:48 | - | |
| Ruka Homes/ | 2024-08-02 11:32 | - | |
| Rurka Homes/ | 2024-12-20 16:02 | - | |
| S.C. Valley Engineer..> | 2022-10-06 19:09 | - | |
| SBS Construction/ | 2024-04-30 13:34 | - | |
| SCC - NY / | 2019-04-04 11:37 | - | |
| SCC-Trial/ | 2020-02-06 13:21 | - | |
| SCC/ | 2018-08-17 13:53 | - | |
| SEM Power/ | 2021-07-21 17:32 | - | |
| SERVPRO of Cerritos/ | 2024-11-01 17:36 | - | |
| SOL Construction Inc./ | 2024-04-30 13:56 | - | |
| Saf-T-Co Supply, Inc./ | 2024-04-30 12:58 | - | |
| Safety Compliance Co..> | 2018-06-04 05:16 | - | |
| Sals Company/ | 2020-10-16 18:29 | - | |
| San Bernardino Valle..> | 2024-06-05 14:37 | - | |
| San Diego Mechanical..> | 2024-04-30 13:14 | - | |
| San Diego Roof Doctors/ | 2024-04-30 13:28 | - | |
| San Joaquin Valley H..> | 2021-01-19 15:08 | - | |
| San Joaquin Valley H..> | 2021-02-25 13:41 | - | |
| San Joaquin Valley H..> | 2024-05-24 12:35 | - | |
| San Joaquin Valley H..> | 2021-03-09 10:32 | - | |
| San Joaquin Valley H..> | 2022-06-28 16:31 | - | |
| San Joaquin Valley H..> | 2022-08-05 17:52 | - | |
| San Mar/ | 2019-04-09 16:33 | - | |
| Santucci Builders, I..> | 2024-06-05 14:37 | - | |
| Savant Construction ..> | 2024-04-30 13:30 | - | |
| Scale Microgrids/ | 2023-09-22 11:03 | - | |
| Schmitt Contracting,..> | 2024-04-30 13:36 | - | |
| Sean Cline Construct..> | 2024-07-10 18:13 | - | |
| Seaside Steel/ | 2025-01-16 17:31 | - | |
| Sebastian Corp./ | 2020-07-20 10:30 | - | |
| Semios/ | 2020-09-03 10:18 | - | |
| Sepulveda Commercial..> | 2019-01-28 19:50 | - | |
| Shawnee Construction..> | 2024-06-05 14:38 | - | |
| Shell Roofing Soluti..> | 2024-06-05 14:47 | - | |
| Shelter Roofing/ | 2023-03-16 16:33 | - | |
| Shermco Services/ | 2019-08-06 11:47 | - | |
| Shoe Stern Packaging/ | 2024-08-15 13:00 | - | |
| Sierra General Contr..> | 2024-06-05 14:48 | - | |
| Signal Air/ | 2024-08-22 11:53 | - | |
| Silicon Valley Glass / | 2021-08-18 14:42 | - | |
| Silverline Construct..> | 2024-04-30 13:42 | - | |
| Silverrock Resort Go..> | 2024-06-05 14:49 | - | |
| Silverwood Landscape..> | 2019-02-15 16:37 | - | |
| Skybridge Renewables..> | 2024-06-05 14:51 | - | |
| Skydive Elsinore/ | 2024-06-05 14:52 | - | |
| Slater Builders, Inc./ | 2024-04-30 13:52 | - | |
| Slater Inc./ | 2024-08-08 14:06 | - | |
| Slater Waterproofing..> | 2024-06-05 14:53 | - | |
| Smellhouse, Inc./ | 2024-06-05 14:54 | - | |
| Smith Brothers Inc./ | 2024-04-30 13:53 | - | |
| Snellenberger Built ..> | 2024-06-14 15:05 | - | |
| Soestern Packaging / | 2025-01-17 13:02 | - | |
| Soffa Electric Inc./ | 2024-04-30 13:55 | - | |
| Sol-Tek/ | 2020-02-06 13:27 | - | |
| Solar Central, Inc./ | 2024-06-14 15:08 | - | |
| Solar Negotiators/ | 2023-08-01 16:29 | - | |
| Soltek / | 2020-10-07 16:26 | - | |
| Sonitrol of Sacramento/ | 2021-02-22 14:17 | - | |
| Southwest Constructi..> | 2024-06-14 15:13 | - | |
| Southwest Plumbing, ..> | 2024-06-14 16:02 | - | |
| SpaceX/ | 2024-04-29 18:45 | - | |
| Span Construction/ | 2019-02-11 19:04 | - | |
| Sparky Electric/ | 2021-05-06 16:41 | - | |
| Spates Fabricators, ..> | 2024-06-14 16:05 | - | |
| Specialized Milling/ | 2024-06-05 14:54 | - | |
| Spencer Enterprises,..> | 2024-04-19 17:16 | - | |
| Standard Constructio..> | 2025-01-30 10:58 | - | |
| Standard Environment..> | 2024-04-30 14:01 | - | |
| Stanley Louis Company/ | 2022-01-05 17:28 | - | |
| Statewide Services Inc/ | 2025-01-17 13:04 | - | |
| Steve Buehler/ | 2021-12-09 18:18 | - | |
| Steve Earl/ | 2019-05-23 14:56 | - | |
| Stoker Construction,..> | 2024-06-05 14:55 | - | |
| Stonecrest Marble & ..> | 2024-06-05 15:35 | - | |
| Strategic Industry/ | 2024-12-30 12:40 | - | |
| Summit Framing, Inc./ | 2024-06-05 15:37 | - | |
| Summit Roofing Solut..> | 2024-04-30 14:03 | - | |
| Sundale Cold Storage/ | 2024-10-11 11:41 | - | |
| Suntech Consulting &..> | 2024-06-05 15:37 | - | |
| Sunwest Electric/ | 2022-02-09 17:53 | - | |
| Superior Constructio..> | 2024-06-05 15:38 | - | |
| Superior Heating & A..> | 2024-06-05 18:48 | - | |
| Superior Roofing Sys..> | 2024-03-08 16:37 | - | |
| Superior Tank Soluti..> | 2021-09-02 12:52 | - | |
| Supreme Drywall, Inc./ | 2024-06-06 10:48 | - | |
| Surmount Solutions/ | 2020-01-21 14:43 | - | |
| Swain Sign Installat..> | 2024-06-06 10:48 | - | |
| T5 Roofing/ | 2024-04-30 14:08 | - | |
| TEI GROUP / | 2024-10-20 16:26 | - | |
| THNC Industries INC/ | 2024-11-13 11:54 | - | |
| TI Construction, Inc./ | 2024-06-06 10:53 | - | |
| TK Construction/ | 2024-06-06 10:55 | - | |
| TMG Transportation, ..> | 2024-04-30 14:37 | - | |
| TWM Roofing/ | 2023-01-17 18:30 | - | |
| Tablerock Concrete I..> | 2024-04-30 14:11 | - | |
| Talion Construction,..> | 2024-05-20 18:25 | - | |
| Talley Metal Fabrica..> | 2024-06-06 10:49 | - | |
| Talley Metal Supply/ | 2024-06-06 10:51 | - | |
| Talley Oil/ | 2024-01-17 11:55 | - | |
| Target Constructors/ | 2020-11-04 12:49 | - | |
| Tarlton and Son/ | 2021-09-02 17:12 | - | |
| Team Sun Construction/ | 2024-06-06 10:51 | - | |
| Tec Color Craft/ | 2022-06-02 12:28 | - | |
| Tecta America/ | 2023-06-21 12:54 | - | |
| Teserra Outdoors/ | 2025-01-17 13:06 | - | |
| Test Company/ | 2024-04-12 10:48 | - | |
| Test Xxain/ | 2019-12-18 10:13 | - | |
| Testing Indigo Divis..> | 2019-01-22 11:26 | - | |
| The Langlois Company/ | 2024-06-06 10:52 | - | |
| The MSH Construction..> | 2024-04-30 14:19 | - | |
| Thermo King Central ..> | 2024-10-24 11:35 | - | |
| Thomas James Homes/ | 2024-04-25 16:19 | - | |
| Thomas James Homes: ..> | 2024-05-15 13:15 | - | |
| Thomas James Homes: ..> | 2024-07-31 15:06 | - | |
| Thomas R. Butler, Inc./ | 2024-04-19 17:37 | - | |
| Thorpe Construction/ | 2021-07-14 11:53 | - | |
| Three D Traffic Works/ | 2024-04-30 14:28 | - | |
| Tiller Constructors ..> | 2024-04-30 14:31 | - | |
| Tim Lewis Construction/ | 2020-06-01 13:15 | - | |
| Timberland Tree Comp..> | 2024-04-30 14:34 | - | |
| Total Interiors Inc./ | 2024-04-30 14:42 | - | |
| Total Telco Speciali..> | 2024-04-30 14:47 | - | |
| Totalplan Business I..> | 2024-06-06 11:04 | - | |
| Tovey Shultz Constru..> | 2019-12-03 17:09 | - | |
| Travis Agricultural ..> | 2021-10-14 15:22 | - | |
| Tri Models/ | 2024-04-26 17:05 | - | |
| Tri Pointe Homes/ | 2022-06-21 17:15 | - | |
| TricorBraun/ | 2024-06-06 11:04 | - | |
| Trident Construction/ | 2021-02-08 12:10 | - | |
| Trilogy Construction..> | 2024-10-04 13:31 | - | |
| Triple H Food Proces..> | 2024-06-06 11:05 | - | |
| Triton Concepts/ | 2025-01-20 14:18 | - | |
| True Frame, Inc./ | 2024-04-19 17:37 | - | |
| True Position Tools/ | 2024-06-06 11:05 | - | |
| Trumark: San Luis Ob..> | 2024-09-24 11:59 | - | |
| Trumark Homes: Centr..> | 2024-09-24 12:00 | - | |
| Trumark Homes: Marina/ | 2024-09-24 12:00 | - | |
| Turnkey Energy/ | 2022-03-23 17:28 | - | |
| Twentynine Palms Wat..> | 2024-06-06 11:06 | - | |
| UC Construction/ | 2023-06-29 10:03 | - | |
| UC Framing/ | 2023-03-13 10:13 | - | |
| URSteel, Inc./ | 2024-06-06 11:11 | - | |
| Ultimate Internet Ac..> | 2022-11-08 23:25 | - | |
| Urata & Sons Concrete/ | 2023-03-06 13:34 | - | |
| Urban Surfaces/ | 2024-06-06 11:07 | - | |
| VIS/ | 2022-07-08 15:58 | - | |
| Valley Air Condition..> | 2019-12-18 17:36 | - | |
| Valley Pipeline Serv..> | 2024-06-06 11:13 | - | |
| Valley Unique Elect..> | 2025-01-17 13:11 | - | |
| Van Matre Lumber "Oa..> | 2024-06-06 11:13 | - | |
| Van Matre Lumber Co...> | 2024-06-06 11:14 | - | |
| Vantage Auctions/ | 2024-06-06 11:15 | - | |
| Variable Speed Solut..> | 2024-04-26 16:50 | - | |
| Verda Steel Corp./ | 2024-06-06 11:16 | - | |
| Vertical MVMT/ | 2025-01-17 13:13 | - | |
| Victoria Club/ | 2024-06-06 11:17 | - | |
| Vision Construction ..> | 2020-11-12 15:19 | - | |
| W.L. Butler Construc..> | 2024-04-30 14:48 | - | |
| WF Construction, Inc./ | 2024-06-06 11:25 | - | |
| WH Jewett, Inc./ | 2024-06-06 11:25 | - | |
| WNG-Agate Apartments/ | 2024-06-05 18:49 | - | |
| WNG-HC At the Resort..> | 2024-06-05 18:50 | - | |
| WNG-Los Olivos Lane/ | 2024-06-05 18:50 | - | |
| Wakeco Inc./ | 2024-06-06 11:19 | - | |
| Wallace Curb & Gutter/ | 2024-06-06 11:19 | - | |
| Walton Construction,..> | 2024-06-03 14:21 | - | |
| Walton Electric Corp..> | 2024-06-06 11:20 | - | |
| Walton Liberty Lane/ | 2025-01-17 13:22 | - | |
| Ware Insurance/ | 2020-03-04 16:03 | - | |
| Watermark Estates Ma..> | 2024-06-06 11:22 | - | |
| Water of Life Commun..> | 2024-06-06 11:21 | - | |
| Wathen Castanos/ | 2023-08-01 16:38 | - | |
| Wathen Castanos: Cen..> | 2023-11-13 13:01 | - | |
| Wathen Castanos: Mar..> | 2023-12-20 14:28 | - | |
| Wathen Castanos: San..> | 2023-09-29 11:46 | - | |
| Weathertight Roofing..> | 2020-02-21 19:06 | - | |
| Weaverbird, LLC/ | 2024-06-06 11:23 | - | |
| Webb Environmental/ | 2023-02-06 15:57 | - | |
| West Builders, Inc./ | 2024-05-01 15:54 | - | |
| West Coast Backhoe &..> | 2024-06-06 11:23 | - | |
| West Coast Roofing Co./ | 2019-11-15 10:48 | - | |
| West Valley Water Di..> | 2024-06-06 11:24 | - | |
| Westech Systems/ | 2025-01-30 14:15 | - | |
| Westech Systems: Com..> | 2020-10-09 08:40 | - | |
| Westech Systems: Res..> | 2022-06-01 18:26 | - | |
| Westech Systems: Ser..> | 2020-11-05 11:19 | - | |
| Westech Systems: Und..> | 2020-10-26 17:02 | - | |
| Western Drywall, Inc./ | 2024-04-19 17:38 | - | |
| Western Drywall/ | 2025-02-18 11:39 | - | |
| Western National Group/ | 2020-01-22 10:03 | - | |
| Western Pacific Roof..> | 2021-01-21 16:34 | - | |
| Western States Glass..> | 2024-04-26 16:37 | - | |
| Westside Contractors/ | 2024-04-26 16:34 | - | |
| Westwood Building Ma..> | 2024-04-26 16:31 | - | |
| William Baile Constr..> | 2024-04-26 16:19 | - | |
| William Morris Devel..> | 2024-06-06 11:26 | - | |
| Winsupply Of The Des..> | 2024-06-06 11:26 | - | |
| Wonderland Homes/ | 2019-03-12 14:23 | - | |
| Woodmont Properties/ | 2024-09-11 10:28 | - | |
| Woodside Homes/ | 2020-03-20 22:55 | - | |
| Woodside Homes: Ariz..> | 2022-07-14 16:17 | - | |
| Woodside Homes: Cent..> | 2020-09-16 17:52 | - | |
| Woodside Homes: Nevada/ | 2020-05-28 14:21 | - | |
| Woodside Homes: Nort..> | 2020-08-24 16:44 | - | |
| Woodside Homes: Sout..> | 2022-08-18 12:33 | - | |
| Woodside Homes: Utah/ | 2022-08-03 13:31 | - | |
| Wrap Up Resource/ | 2024-06-20 12:23 | - | |
| Wright Contracting/ | 2024-05-28 11:26 | - | |
| Wright Homes/ | 2020-08-20 11:29 | - | |
| Yarbs Grading & Pavi..> | 2024-07-16 16:38 | - | |
| Young Electric Sign ..> | 2024-06-06 11:27 | - | |
| Youngs Air/ | 2020-03-10 13:03 | - | |
| Yucaipa Auto Collision/ | 2024-06-06 11:28 | - | |
| Yucaipa Valley Regio..> | 2024-06-06 11:29 | - | |
| Yucaipa Valley Water..> | 2024-06-06 11:34 | - | |
| Zimmerman Development/ | 2024-12-13 16:51 | - | |
| Zumwalt Construction/ | 2019-06-17 13:04 | - | |
| a-m-biomedical/ | 2024-12-17 23:03 | - | |
| a-one-roof-management/ | 2024-09-20 19:05 | - | |
| aaa-paving-company/ | 2024-10-08 22:35 | - | |
| ac-enterprises/ | 2025-02-21 19:36 | - | |
| accel-framing-genera..> | 2025-02-25 13:40 | - | |
| adco-roofing-waterpr..> | 2025-02-22 16:13 | - | |
| adco-south-roofing-w..> | 2024-10-09 20:24 | - | |
| air-conditioning-sol..> | 2025-03-02 23:45 | - | |
| al/ | 2018-08-16 07:37 | - | |
| albino-construction-..> | 2024-07-01 18:09 | - | |
| all-seasons-north-ro..> | 2024-07-18 17:14 | - | |
| alta-roofing-waterpr..> | 2025-01-30 09:50 | - | |
| amcal/ | 2024-05-09 14:51 | - | |
| [email protected]/ | 2021-04-19 12:36 | - | |
| apex-fire-systems-inc/ | 2025-01-30 16:46 | - | |
| arantine-hills-holdi..> | 2024-05-02 16:26 | - | |
| ardent-general-inc/ | 2024-11-28 15:00 | - | |
| ashwood-construction..> | 2024-06-25 17:33 | - | |
| atlas-roofing-waerpr..> | 2025-02-24 21:48 | - | |
| b-b-construction-ser..> | 2025-02-13 20:21 | - | |
| ba2-llc/ | 2024-10-04 23:22 | - | |
| baghouse-industrial-..> | 2024-10-17 17:14 | - | |
| baldwin-construction/ | 2024-12-04 11:30 | - | |
| barnhart-benson-buil..> | 2024-05-02 17:05 | - | |
| bay-city-boiler/ | 2025-02-26 12:50 | - | |
| baymar-constructors-..> | 2024-09-24 16:47 | - | |
| baymarr-constructors..> | 2025-02-21 17:31 | - | |
| bcs-enterprises-inc/ | 2025-01-24 19:14 | - | |
| bedrosian/ | 2024-12-31 00:14 | - | |
| best-framing/ | 2025-01-02 14:42 | - | |
| bj-perch-construction/ | 2025-01-07 11:56 | - | |
| blc-tesoro/ | 2024-12-24 01:43 | - | |
| block-tops/ | 2025-01-29 01:06 | - | |
| bmy-construction/ | 2025-01-27 19:35 | - | |
| bob-marshall-constru..> | 2024-06-06 01:39 | - | |
| bogh-engineering-inc/ | 2025-02-10 17:05 | - | |
| bonadelle-homes-inc/ | 2025-01-22 20:40 | - | |
| bradshaw-constructio..> | 2024-11-25 16:33 | - | |
| bright-homes/ | 2024-05-20 18:53 | - | |
| browning-contractors..> | 2024-08-07 17:37 | - | |
| c-a-hofmann-construc..> | 2024-06-25 18:57 | - | |
| cal-custom-tile/ | 2025-02-07 10:59 | - | |
| california-commercia..> | 2025-02-17 21:48 | - | |
| california-tile-inst..> | 2024-10-03 14:32 | - | |
| callaghan-concrete-c..> | 2025-01-20 20:21 | - | |
| calpac-sheet-metal/ | 2025-01-16 02:04 | - | |
| can-lines-engineerin..> | 2024-09-11 14:18 | - | |
| caster-properties-inc/ | 2024-06-13 16:45 | - | |
| cencal-builders/ | 2025-02-04 17:11 | - | |
| cencal-services/ | 2025-02-28 13:37 | - | |
| century-communities-..> | 2024-09-11 21:49 | - | |
| century-communities/ | 2024-05-23 12:23 | - | |
| chesmar-homes-austin/ | 2025-02-26 06:27 | - | |
| chesmar-homes-centra..> | 2025-02-05 15:56 | - | |
| chesmar-homes-dallas..> | 2025-02-20 09:18 | - | |
| chesmar-homes-dallas..> | 2024-11-14 16:46 | - | |
| chesmar-homes-dfw-east/ | 2024-08-21 16:12 | - | |
| chesmar-homes-dfw-west/ | 2024-12-12 09:32 | - | |
| chesmar-homes-housto..> | 2024-12-12 20:09 | - | |
| chesmar-homes-housto..> | 2025-02-28 19:07 | - | |
| chesmar-homes-housto..> | 2025-02-27 08:41 | - | |
| chesmar-homes-san-an..> | 2025-02-26 00:36 | - | |
| christensen-construc..> | 2024-12-05 10:27 | - | |
| circle-city-roofing-..> | 2024-09-26 19:24 | - | |
| city-of-carson/ | 2024-07-01 11:00 | - | |
| cjw-general-contract..> | 2025-01-27 23:27 | - | |
| clovis-recycling-cen..> | 2025-01-15 17:07 | - | |
| cm-dredging/ | 2025-01-17 06:33 | - | |
| commerce-constructio..> | 2024-09-04 01:09 | - | |
| concrete-north-inc/ | 2024-12-02 09:40 | - | |
| confab-construction-..> | 2025-01-27 19:16 | - | |
| core-contracting-inc/ | 2024-09-27 16:24 | - | |
| corridor-recycling/ | 2024-12-26 14:44 | - | |
| crawford-custom-homes/ | 2025-01-31 12:59 | - | |
| critical-electric-sy..> | 2024-09-30 22:21 | - | |
| crosstown-electrical..> | 2025-02-28 10:03 | - | |
| crosstown-electrical..> | 2025-02-04 10:22 | - | |
| crosstown-electrical..> | 2025-02-14 11:29 | - | |
| crosstown-electrical..> | 2025-02-12 09:52 | - | |
| crosstown-electrical..> | 2025-02-18 18:20 | - | |
| crosstown-electrical..> | 2025-02-28 20:02 | - | |
| cw-dillon/ | 2024-08-19 12:11 | - | |
| dai-general-contract..> | 2024-08-20 10:24 | - | |
| dai/ | 2025-02-27 00:17 | - | |
| damato-associates-inc/ | 2025-02-20 02:31 | - | |
| data-impressions-di-..> | 2024-09-23 20:21 | - | |
| davis-moreno-constru..> | 2024-05-23 21:17 | - | |
| dayan-industries/ | 2024-07-21 16:42 | - | |
| dbac-inc/ | 2025-02-27 18:58 | - | |
| dbko-design-and-build/ | 2025-02-27 23:58 | - | |
| ddcm-inc/ | 2025-01-10 15:55 | - | |
| dr-horton-americas-b..> | 2025-01-02 12:50 | - | |
| dr-horton-americas-b..> | 2025-02-21 17:49 | - | |
| dr-horton-central-va..> | 2025-02-21 19:32 | - | |
| dr-horton-inc-califo..> | 2025-01-23 00:09 | - | |
| dr-horton-inc-reno/ | 2024-12-04 13:55 | - | |
| dr-horton-roseville/ | 2024-07-24 09:02 | - | |
| dr-horton-sacramento/ | 2024-08-29 12:41 | - | |
| dr-horton/ | 2025-03-02 15:20 | - | |
| dscm-inc/ | 2024-10-29 00:23 | - | |
| durham-construction-..> | 2024-06-22 12:16 | - | |
| dw-johnston-construc..> | 2024-07-02 00:44 | - | |
| east-gardenswest-gar..> | 2024-09-11 19:36 | - | |
| ed-grush-general-con..> | 2024-08-19 20:52 | - | |
| eer-inc/ | 2025-02-28 10:51 | - | |
| ej-meyers-company/ | 2024-06-16 19:11 | - | |
| ekc/ | 2024-05-07 15:51 | - | |
| ekedal-concrete-inc/ | 2025-02-25 23:24 | - | |
| elliottdrinkward-con..> | 2025-02-27 21:52 | - | |
| emmerson-constructio..> | 2024-11-07 10:45 | - | |
| emmett-valley-constr..> | 2025-02-13 20:06 | - | |
| fairfield/ | 2024-12-13 03:00 | - | |
| fcb-homes/ | 2024-05-03 19:49 | - | |
| fec-electrical-contr..> | 2024-10-14 20:04 | - | |
| fieldstone-homes-utah/ | 2024-04-29 12:44 | - | |
| fieldstone-homes/ | 2025-01-28 15:59 | - | |
| fix-auto-puget-colli..> | 2024-09-03 13:07 | - | |
| fresno-concrete-cons..> | 2024-09-20 01:57 | - | |
| fresno-valve-casting/ | 2024-09-09 18:06 | - | |
| gary-mcdonald-homes-..> | 2025-01-10 16:20 | - | |
| genova-construction-..> | 2025-01-23 00:00 | - | |
| gj-gentry-general-en..> | 2025-02-28 19:24 | - | |
| gl-bruno/ | 2025-01-15 17:27 | - | |
| gluck-building-company/ | 2025-02-19 13:50 | - | |
| go-langlois-construc..> | 2024-08-12 22:36 | - | |
| gonzalez-incorporated/ | 2024-11-14 13:37 | - | |
| graham-prewett/ | 2025-02-28 18:27 | - | |
| granite-mountain-sto..> | 2024-11-26 21:31 | - | |
| granville-homes-inc/ | 2024-08-08 10:10 | - | |
| granville-homes/ | 2025-01-22 18:19 | - | |
| greystone-plastering/ | 2025-02-27 00:41 | - | |
| guy-yocom-construction/ | 2025-02-27 20:14 | - | |
| hamlet-homes-utah/ | 2024-08-22 17:56 | - | |
| hbi-construction-inc/ | 2024-11-25 13:48 | - | |
| helio/ | 2024-09-09 19:13 | - | |
| hmc-construction/ | 2025-02-11 16:41 | - | |
| hodgdon-management-a..> | 2024-11-04 19:24 | - | |
| holt-homes/ | 2025-02-28 16:58 | - | |
| hoyt-roofs-inc/ | 2024-12-06 10:09 | - | |
| hubble-homes/ | 2025-01-16 10:54 | - | |
| huff-construction-co..> | 2025-02-17 12:19 | - | |
| humphrey-plumbing/ | 2025-02-12 09:34 | - | |
| icon-west/ | 2024-09-03 18:42 | - | |
| indigoicon-new/ | 2024-10-08 09:12 | - | |
| inland-building-cons..> | 2024-10-17 19:21 | - | |
| innovative-metal-ind..> | 2024-07-16 09:05 | - | |
| interface-air-repair..> | 2024-12-26 12:35 | - | |
| ironcore-construction/ | 2024-09-18 17:41 | - | |
| j-matt-construction-co/ | 2024-09-16 15:17 | - | |
| jal-inc/ | 2024-05-22 01:06 | - | |
| jan-building/ | 2025-02-28 19:37 | - | |
| jim-crawford-constru..> | 2025-02-27 20:53 | - | |
| jim-murray-roofing-inc/ | 2025-03-02 15:50 | - | |
| jman-at-the-q-lp/ | 2024-11-25 05:20 | - | |
| jon-casey-constructi..> | 2025-01-29 16:56 | - | |
| js-sullivan-construc..> | 2024-06-11 13:03 | - | |
| jsb-builders-inc/ | 2024-12-24 19:52 | - | |
| jwcib-inc-dba-cavignac/ | 2025-02-21 19:35 | - | |
| k6-construction-inc/ | 2025-01-06 11:27 | - | |
| karsyn-construction/ | 2025-01-22 22:23 | - | |
| kincaid-construction..> | 2024-05-07 12:37 | - | |
| krikorian-constructi..> | 2024-08-20 17:52 | - | |
| larry-jacinto-constr..> | 2025-02-17 21:59 | - | |
| legacy-construction/ | 2025-02-10 10:10 | - | |
| legacy-stoneworks-in..> | 2025-01-27 18:42 | - | |
| lennar-homes-of-cali..> | 2025-02-21 18:55 | - | |
| lucas-builders-inc/ | 2025-03-01 01:26 | - | |
| lyle-parks-jr-constr..> | 2025-02-24 14:32 | - | |
| majestic-masonry/ | 2024-12-09 19:12 | - | |
| mark-wilson-construc..> | 2025-02-21 09:32 | - | |
| marvulli-inc/ | 2024-11-11 10:45 | - | |
| mccaffrey-homes/ | 2024-12-13 15:02 | - | |
| mch-electric/ | 2025-01-21 18:33 | - | |
| mckellar-mcgowan-llc/ | 2024-05-16 20:47 | - | |
| mcrt-california-cons..> | 2024-05-06 18:44 | - | |
| mcrt-socal-construct..> | 2024-12-18 19:36 | - | |
| merit-framing-incorp..> | 2025-01-27 22:57 | - | |
| meyers-construction/ | 2025-01-26 13:33 | - | |
| miller-construction/ | 2025-02-10 17:16 | - | |
| moldings-plus-inc/ | 2025-02-17 22:19 | - | |
| moore-quality-galvan..> | 2024-09-09 17:26 | - | |
| morris-construction-..> | 2024-04-24 13:24 | - | |
| near-cal-corporation/ | 2025-01-20 22:27 | - | |
| neff-construction-inc/ | 2025-02-26 10:37 | - | |
| nplc-lost-canyons-llc/ | 2024-11-19 04:41 | - | |
| nucor-data-systems-m..> | 2025-01-31 06:39 | - | |
| nvb-equipment/ | 2025-02-19 12:06 | - | |
| oc-metals/ | 2024-08-13 13:19 | - | |
| olea-kiosks-inc/ | 2024-05-30 18:13 | - | |
| omega-electric/ | 2024-09-30 15:24 | - | |
| ovation/ | 2024-09-11 20:11 | - | |
| pabon-construction-c..> | 2024-10-21 19:52 | - | |
| pace-punches-inc/ | 2024-05-19 22:04 | - | |
| pacific-apartment-ho..> | 2024-10-01 15:19 | - | |
| pacific-crest-roofing/ | 2025-01-14 18:10 | - | |
| pacific-door/ | 2024-08-05 21:59 | - | |
| pacific-hydrotech-co..> | 2025-02-26 16:38 | - | |
| pacific-hydrotech/ | 2024-04-24 16:37 | - | |
| pack-plus-converting/ | 2024-11-17 14:56 | - | |
| parkwest-constructio..> | 2024-07-29 21:14 | - | |
| pciw-steel-corporation/ | 2024-10-28 12:36 | - | |
| perry-homesutah/ | 2025-03-03 14:50 | - | |
| pooles-construction-..> | 2024-12-13 12:02 | - | |
| portrait-constructio..> | 2024-10-15 02:57 | - | |
| positive-electric-co/ | 2024-04-29 05:41 | - | |
| post-bros-constructi..> | 2025-02-24 12:53 | - | |
| powerflex/ | 2025-02-26 19:25 | - | |
| precise General Cont..> | 2020-02-11 18:21 | - | |
| pro-craft-constructi..> | 2025-02-25 01:13 | - | |
| pro-craft-construction/ | 2024-04-16 10:53 | - | |
| pro-craft/ | 2024-04-29 17:59 | - | |
| prowest-constructors/ | 2024-10-14 19:08 | - | |
| purus-international-..> | 2024-09-09 22:11 | - | |
| pyro-comm-systems-in..> | 2024-08-06 16:57 | - | |
| pyro-comm-systems-in..> | 2025-02-21 15:51 | - | |
| related-california-s..> | 2024-05-13 19:05 | - | |
| retrofit-services/ | 2024-07-15 22:02 | - | |
| riffe-international-..> | 2024-10-24 13:07 | - | |
| ris-electrical-contr..> | 2025-02-24 21:27 | - | |
| riverside-steel-inc/ | 2024-10-31 19:35 | - | |
| rj-noble-company/ | 2024-12-26 12:14 | - | |
| rmc-construction/ | 2024-04-17 17:30 | - | |
| rmc-constructors/ | 2024-09-20 11:54 | - | |
| rockne-construction-..> | 2024-06-26 01:38 | - | |
| roland-construction/ | 2024-10-28 11:41 | - | |
| ross-carroll-inc/ | 2024-08-08 11:17 | - | |
| ross-f-carroll-inc/ | 2024-11-20 21:19 | - | |
| rubicon-gear-inc/ | 2025-01-02 18:43 | - | |
| rubik-built-llc/ | 2025-02-10 18:16 | - | |
| rurka-homes/ | 2025-01-28 18:54 | - | |
| safety-compliance-co..> | 2025-02-23 22:14 | - | |
| san-joaquin-valley-h..> | 2024-10-09 10:06 | - | |
| san-joaquin-valley-h..> | 2024-09-10 10:12 | - | |
| savant-construction-..> | 2024-08-14 18:57 | - | |
| sc-valley-engineerin..> | 2025-02-27 19:31 | - | |
| sc-valley-engineering/ | 2024-12-07 10:15 | - | |
| scc/ | 2025-01-27 13:41 | - | |
| schmitt-contracting-..> | 2025-01-29 13:24 | - | |
| seaside-steel-inc/ | 2025-02-27 19:26 | - | |
| sebastian-corp/ | 2025-02-26 11:11 | - | |
| shoestern-packaging/ | 2024-08-20 17:00 | - | |
| silverline-construct..> | 2024-11-05 16:10 | - | |
| silverwood-landscape..> | 2025-02-24 12:27 | - | |
| sjv-construction-ser..> | 2024-11-07 20:40 | - | |
| slater-builders/ | 2024-08-17 00:09 | - | |
| slater-inc/ | 2025-02-24 21:51 | - | |
| soestern-packaging/ | 2025-02-24 12:04 | - | |
| soffa-electric-inc/ | 2024-08-09 01:36 | - | |
| somerset-crossing/ | 2024-08-30 01:26 | - | |
| spacex/ | 2024-07-17 01:28 | - | |
| specialized-milling/ | 2025-02-03 20:59 | - | |
| spencer-enterprises-..> | 2024-05-13 12:34 | - | |
| standard-constructio..> | 2025-01-30 18:46 | - | |
| statewide-services-inc/ | 2024-12-13 13:13 | - | |
| stoker-construction-..> | 2024-08-12 20:36 | - | |
| strategic-industry/ | 2025-01-27 13:49 | - | |
| sundale-cold-storage/ | 2024-10-14 20:32 | - | |
| sunwest-electric-inc/ | 2025-01-17 20:16 | - | |
| superior-constructio..> | 2024-12-18 20:13 | - | |
| superior-roofing-sys..> | 2025-01-08 19:40 | - | |
| superior-tank-soluti..> | 2025-02-26 12:27 | - | |
| talion-construction-..> | 2024-05-20 20:17 | - | |
| target-constructors-..> | 2025-01-22 14:19 | - | |
| team-sun-construction/ | 2024-11-11 21:47 | - | |
| tecta-america-inc/ | 2025-02-25 22:58 | - | |
| teserra-outdoors/ | 2025-01-13 22:56 | - | |
| test-company/ | 2025-02-24 23:22 | - | |
| test-indigo/ | 2024-05-05 09:29 | - | |
| test indigo/ | 2018-08-20 10:12 | - | |
| the-orchard-acres/ | 2024-08-31 09:55 | - | |
| the-park-granite-bay/ | 2024-09-03 22:18 | - | |
| thermo-king-central-..> | 2025-02-19 12:48 | - | |
| thomas-james-homes-n..> | 2025-02-27 14:12 | - | |
| thomas-james-homes-s..> | 2025-02-28 17:08 | - | |
| thomas-r-butler-inc/ | 2024-10-16 22:20 | - | |
| three-d-traffic-works/ | 2024-09-13 12:24 | - | |
| tiller-constructors-..> | 2024-12-03 12:48 | - | |
| total-interiors-inc/ | 2024-10-22 02:55 | - | |
| trilogy-construction..> | 2024-11-11 10:42 | - | |
| triton-concepts/ | 2025-01-17 15:39 | - | |
| true-frame-inc/ | 2025-02-28 13:24 | - | |
| trumark-homes-centra..> | 2024-09-04 12:02 | - | |
| trumark-homes-clovis/ | 2025-01-28 19:18 | - | |
| trumark-homes-marina/ | 2024-11-19 17:46 | - | |
| trumark-san-luis-obi..> | 2025-01-17 15:18 | - | |
| uc-construction/ | 2024-12-11 19:54 | - | |
| uc-framing/ | 2025-02-20 18:37 | - | |
| valley-air-condition..> | 2025-01-23 10:43 | - | |
| valley-pipeline-serv..> | 2025-02-03 22:51 | - | |
| valley-unique-electric/ | 2025-02-13 20:10 | - | |
| vertical-mvmt/ | 2024-10-01 13:14 | - | |
| victoria-homes-proje..> | 2024-08-06 14:23 | - | |
| wallace-curb-gutter/ | 2025-02-03 23:36 | - | |
| walton-construction-..> | 2025-01-17 21:47 | - | |
| west-builders-inc/ | 2024-06-18 19:45 | - | |
| westech-systems-comm..> | 2025-02-25 12:50 | - | |
| westech-systems-inc/ | 2024-08-13 17:02 | - | |
| western-drywall-inc/ | 2025-02-28 00:46 | - | |
| western-national-bui..> | 2025-02-26 10:32 | - | |
| western-national-con..> | 2025-02-28 23:17 | - | |
| westside-contractors/ | 2024-05-08 00:24 | - | |
| wh-jewett-inc/ | 2025-02-03 22:27 | - | |
| wilson-homes/ | 2024-10-29 15:15 | - | |
| wl-butler-constructi..> | 2025-02-28 14:36 | - | |
| woodmont-properties/ | 2024-09-11 11:28 | - | |
| woodside-home-os-cal..> | 2024-05-09 14:37 | - | |
| woodside-home-southe..> | 2024-06-24 20:34 | - | |
| woodside-homes-arizona/ | 2024-08-22 15:06 | - | |
| woodside-homes-centr..> | 2025-02-19 11:46 | - | |
| woodside-homes-nevada/ | 2025-02-26 18:32 | - | |
| woodside-homes-north..> | 2024-10-30 13:49 | - | |
| woodside-homes-of-fr..> | 2024-05-09 14:32 | - | |
| woodside-homes-south..> | 2025-01-31 10:00 | - | |
| woodside-homes-south..> | 2024-05-10 13:40 | - | |
| woodside-homes-utah/ | 2024-10-11 13:23 | - | |
| woodside-homes/ | 2024-09-04 18:20 | - | |
| wrap-up-resource/ | 2024-06-24 10:56 | - | |
| wright-contracting/ | 2024-11-13 16:57 | - | |
| wright-homes/ | 2024-12-23 10:12 | - | |
| yarbs-grading-paving..> | 2024-07-18 23:29 | - | |
| youngs-air/ | 2024-10-02 17:50 | - | |
| zimmerman-development/ | 2024-12-15 14:41 | - | |
| zumwalt-construction/ | 2024-12-19 00:31 | - | |
|
|---|